C14H15N3O4 — CID 3759870
ethyl N-[2-cyano-3-(4-methoxyanilino)prop-2-enoyl]carbamate (PubChem CID 3759870) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is ethyl N-[2-cyano-3-(4-methoxyanilino)prop-2-enoyl]carbamate.
| Compound Name | ethyl N-[2-cyano-3-(4-methoxyanilino)prop-2-enoyl]carbamate |
|---|---|
| PubChem CID | 3759870 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | ethyl N-[2-cyano-3-(4-methoxyanilino)prop-2-enoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(C#N)=CNc1ccc(OC)cc1 |
| InChI | InChI=1S/C14H15N3O4/c1-3-21-14(19)17-13(18)10(8-15)9-16-11-4-6-12(20-2)7-5-11/h4-7,9,16H,3H2,1-2H3,(H,17,18,19) |
| InChIKey | BPALQSKBEZDFPE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|