C17H13F2N3O2 — CID 108821058
(Z)-2-cyano-3-(2,6-difluoroanilino)-N-(2-methoxyphenyl)prop-2-enamide (PubChem CID 108821058) has the molecular formula C17H13F2N3O2 and a molecular weight of 329.31 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,6-difluoroanilino)-N-(2-methoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,6-difluoroanilino)-N-(2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108821058 |
| Molecular Formula | C17H13F2N3O2 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | (Z)-2-cyano-3-(2,6-difluoroanilino)-N-(2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccccc1NC(=O)/C(C#N)=C\Nc1c(F)cccc1F |
| InChI | InChI=1S/C17H13F2N3O2/c1-24-15-8-3-2-7-14(15)22-17(23)11(9-20)10-21-16-12(18)5-4-6-13(16)19/h2-8,10,21H,1H3,(H,22,23)/b11-10- |
| InChIKey | QYVADEKYHGUEOU-KHPPLWFESA-N |
| XLogP | 3.43 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|