C15H12BrN5O2 — CID 108821248
(Z)-3-[(5-bromopyrimidin-2-yl)amino]-2-cyano-N-(2-methoxyphenyl)prop-2-enamide (PubChem CID 108821248) has the molecular formula C15H12BrN5O2 and a molecular weight of 374.20 g/mol. Its IUPAC name is (Z)-3-[(5-bromopyrimidin-2-yl)amino]-2-cyano-N-(2-methoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[(5-bromopyrimidin-2-yl)amino]-2-cyano-N-(2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108821248 |
| Molecular Formula | C15H12BrN5O2 |
| Molecular Weight | 374.20 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | (Z)-3-[(5-bromopyrimidin-2-yl)amino]-2-cyano-N-(2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccccc1NC(=O)/C(C#N)=C\Nc1ncc(Br)cn1 |
| InChI | InChI=1S/C15H12BrN5O2/c1-23-13-5-3-2-4-12(13)21-14(22)10(6-17)7-18-15-19-8-11(16)9-20-15/h2-5,7-9H,1H3,(H,21,22)(H,18,19,20)/b10-7- |
| InChIKey | CPXNYEMWKMWJNC-YFHOEESVSA-N |
| XLogP | 2.71 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.20 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|