C16H12BrN5O2 — CID 108856944
(Z)-N-(3-acetylphenyl)-3-[(5-bromopyrimidin-2-yl)amino]-2-cyanoprop-2-enamide (PubChem CID 108856944) has the molecular formula C16H12BrN5O2 and a molecular weight of 386.21 g/mol. Its IUPAC name is (Z)-N-(3-acetylphenyl)-3-[(5-bromopyrimidin-2-yl)amino]-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-(3-acetylphenyl)-3-[(5-bromopyrimidin-2-yl)amino]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108856944 |
| Molecular Formula | C16H12BrN5O2 |
| Molecular Weight | 386.21 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | (Z)-N-(3-acetylphenyl)-3-[(5-bromopyrimidin-2-yl)amino]-2-cyanoprop-2-enamide |
| SMILES | CC(=O)c1cccc(NC(=O)/C(C#N)=C\Nc2ncc(Br)cn2)c1 |
| InChI | InChI=1S/C16H12BrN5O2/c1-10(23)11-3-2-4-14(5-11)22-15(24)12(6-18)7-19-16-20-8-13(17)9-21-16/h2-5,7-9H,1H3,(H,22,24)(H,19,20,21)/b12-7- |
| InChIKey | FBXNYIBGKJNFKQ-GHXNOFRVSA-N |
| XLogP | 2.90 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|