C18H13Cl2N3O2 — CID 108821752
(Z)-3-(3-acetylanilino)-2-cyano-N-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 108821752) has the molecular formula C18H13Cl2N3O2 and a molecular weight of 374.23 g/mol. Its IUPAC name is (Z)-3-(3-acetylanilino)-2-cyano-N-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (Z)-3-(3-acetylanilino)-2-cyano-N-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108821752 |
| Molecular Formula | C18H13Cl2N3O2 |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | (Z)-3-(3-acetylanilino)-2-cyano-N-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | CC(=O)c1cccc(N/C=C(/C#N)C(=O)Nc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C18H13Cl2N3O2/c1-11(24)12-3-2-4-14(7-12)22-10-13(9-21)18(25)23-15-5-6-16(19)17(20)8-15/h2-8,10,22H,1H3,(H,23,25)/b13-10- |
| InChIKey | OIFHQVVGOQARIK-RAXLEYEMSA-N |
| XLogP | 4.65 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|