C14H13N3O3 — CID 98698649
(Z)-N-acetyl-3-(3-acetylanilino)-2-cyanoprop-2-enamide (PubChem CID 98698649) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is (Z)-N-acetyl-3-(3-acetylanilino)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-acetyl-3-(3-acetylanilino)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 98698649 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | (Z)-N-acetyl-3-(3-acetylanilino)-2-cyanoprop-2-enamide |
| SMILES | CC(=O)NC(=O)/C(C#N)=C\Nc1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C14H13N3O3/c1-9(18)11-4-3-5-13(6-11)16-8-12(7-15)14(20)17-10(2)19/h3-6,8,16H,1-2H3,(H,17,19,20)/b12-8- |
| InChIKey | LHJLQPBXDNOGBY-WQLSENKSSA-N |
| XLogP | 1.37 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|