C19H14N4O2 — CID 108856731
(Z)-N-(3-acetylphenyl)-2-cyano-3-(4-cyanoanilino)prop-2-enamide (PubChem CID 108856731) has the molecular formula C19H14N4O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is (Z)-N-(3-acetylphenyl)-2-cyano-3-(4-cyanoanilino)prop-2-enamide.
| Compound Name | (Z)-N-(3-acetylphenyl)-2-cyano-3-(4-cyanoanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108856731 |
| Molecular Formula | C19H14N4O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | (Z)-N-(3-acetylphenyl)-2-cyano-3-(4-cyanoanilino)prop-2-enamide |
| SMILES | CC(=O)c1cccc(NC(=O)/C(C#N)=C\Nc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C19H14N4O2/c1-13(24)15-3-2-4-18(9-15)23-19(25)16(11-21)12-22-17-7-5-14(10-20)6-8-17/h2-9,12,22H,1H3,(H,23,25)/b16-12- |
| InChIKey | RMHCSMHEIBBSCR-VBKFSLOCSA-N |
| XLogP | 3.22 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|