C19H16N4O3 — CID 108856838
4-[[(Z)-3-(3-acetylanilino)-2-cyano-3-oxoprop-1-enyl]amino]benzamide (PubChem CID 108856838) has the molecular formula C19H16N4O3 and a molecular weight of 348.36 g/mol. Its IUPAC name is 4-[[(Z)-3-(3-acetylanilino)-2-cyano-3-oxoprop-1-enyl]amino]benzamide.
| Compound Name | 4-[[(Z)-3-(3-acetylanilino)-2-cyano-3-oxoprop-1-enyl]amino]benzamide |
|---|---|
| PubChem CID | 108856838 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 4-[[(Z)-3-(3-acetylanilino)-2-cyano-3-oxoprop-1-enyl]amino]benzamide |
| SMILES | CC(=O)c1cccc(NC(=O)/C(C#N)=C\Nc2ccc(C(N)=O)cc2)c1 |
| InChI | InChI=1S/C19H16N4O3/c1-12(24)14-3-2-4-17(9-14)23-19(26)15(10-20)11-22-16-7-5-13(6-8-16)18(21)25/h2-9,11,22H,1H3,(H2,21,25)(H,23,26)/b15-11- |
| InChIKey | BOKQHLSEYMRZNN-PTNGSMBKSA-N |
| XLogP | 2.45 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|