C18H16Cl2N4O — CID 108821856
(Z)-2-cyano-N-(3,4-dichlorophenyl)-3-[4-(dimethylamino)anilino]prop-2-enamide (PubChem CID 108821856) has the molecular formula C18H16Cl2N4O and a molecular weight of 375.26 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3,4-dichlorophenyl)-3-[4-(dimethylamino)anilino]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3,4-dichlorophenyl)-3-[4-(dimethylamino)anilino]prop-2-enamide |
|---|---|
| PubChem CID | 108821856 |
| Molecular Formula | C18H16Cl2N4O |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | (Z)-2-cyano-N-(3,4-dichlorophenyl)-3-[4-(dimethylamino)anilino]prop-2-enamide |
| SMILES | CN(C)c1ccc(N/C=C(/C#N)C(=O)Nc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H16Cl2N4O/c1-24(2)15-6-3-13(4-7-15)22-11-12(10-21)18(25)23-14-5-8-16(19)17(20)9-14/h3-9,11,22H,1-2H3,(H,23,25)/b12-11- |
| InChIKey | BYIXBHRFDCFWDB-QXMHVHEDSA-N |
| XLogP | 4.52 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|