C14H8BrCl2N5O — CID 108821994
(Z)-3-[(5-bromopyrimidin-2-yl)amino]-2-cyano-N-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 108821994) has the molecular formula C14H8BrCl2N5O and a molecular weight of 413.06 g/mol. Its IUPAC name is (Z)-3-[(5-bromopyrimidin-2-yl)amino]-2-cyano-N-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (Z)-3-[(5-bromopyrimidin-2-yl)amino]-2-cyano-N-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108821994 |
| Molecular Formula | C14H8BrCl2N5O |
| Molecular Weight | 413.06 g/mol |
| Exact Mass | 410.93 |
| IUPAC Name | (Z)-3-[(5-bromopyrimidin-2-yl)amino]-2-cyano-N-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ncc(Br)cn1)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H8BrCl2N5O/c15-9-6-20-14(21-7-9)19-5-8(4-18)13(23)22-10-1-2-11(16)12(17)3-10/h1-3,5-7H,(H,22,23)(H,19,20,21)/b8-5- |
| InChIKey | WFUIRSJKZYXXMW-YVMONPNESA-N |
| XLogP | 4.00 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.06 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|