C17H12Cl2N4O2 — CID 108821872
2-amino-N-[(Z)-2-cyano-3-(3,4-dichloroanilino)-3-oxoprop-1-enyl]benzamide (PubChem CID 108821872) has the molecular formula C17H12Cl2N4O2 and a molecular weight of 375.22 g/mol. Its IUPAC name is 2-amino-N-[(Z)-2-cyano-3-(3,4-dichloroanilino)-3-oxoprop-1-enyl]benzamide.
| Compound Name | 2-amino-N-[(Z)-2-cyano-3-(3,4-dichloroanilino)-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 108821872 |
| Molecular Formula | C17H12Cl2N4O2 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 2-amino-N-[(Z)-2-cyano-3-(3,4-dichloroanilino)-3-oxoprop-1-enyl]benzamide |
| SMILES | N#C/C(=C/NC(=O)c1ccccc1N)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H12Cl2N4O2/c18-13-6-5-11(7-14(13)19)23-16(24)10(8-20)9-22-17(25)12-3-1-2-4-15(12)21/h1-7,9H,21H2,(H,22,25)(H,23,24)/b10-9- |
| InChIKey | NQCPAUCUGCDAEV-KTKRTIGZSA-N |
| XLogP | 3.35 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|