C18H12ClF3N4O2 — CID 108859073
4-amino-N-[(Z)-3-[4-chloro-3-(trifluoromethyl)anilino]-2-cyano-3-oxoprop-1-enyl]benzamide (PubChem CID 108859073) has the molecular formula C18H12ClF3N4O2 and a molecular weight of 408.77 g/mol. Its IUPAC name is 4-amino-N-[(Z)-3-[4-chloro-3-(trifluoromethyl)anilino]-2-cyano-3-oxoprop-1-enyl]benzamide.
| Compound Name | 4-amino-N-[(Z)-3-[4-chloro-3-(trifluoromethyl)anilino]-2-cyano-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 108859073 |
| Molecular Formula | C18H12ClF3N4O2 |
| Molecular Weight | 408.77 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 4-amino-N-[(Z)-3-[4-chloro-3-(trifluoromethyl)anilino]-2-cyano-3-oxoprop-1-enyl]benzamide |
| SMILES | N#C/C(=C/NC(=O)c1ccc(N)cc1)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H12ClF3N4O2/c19-15-6-5-13(7-14(15)18(20,21)22)26-17(28)11(8-23)9-25-16(27)10-1-3-12(24)4-2-10/h1-7,9H,24H2,(H,25,27)(H,26,28)/b11-9- |
| InChIKey | ZZQRVLIJBCJTEG-LUAWRHEFSA-N |
| XLogP | 3.72 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.77 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|