C14H10ClF3N4O — CID 108859188
(Z)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyano-3-(2-cyanoethylamino)prop-2-enamide (PubChem CID 108859188) has the molecular formula C14H10ClF3N4O and a molecular weight of 342.71 g/mol. Its IUPAC name is (Z)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyano-3-(2-cyanoethylamino)prop-2-enamide.
| Compound Name | (Z)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyano-3-(2-cyanoethylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108859188 |
| Molecular Formula | C14H10ClF3N4O |
| Molecular Weight | 342.71 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | (Z)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyano-3-(2-cyanoethylamino)prop-2-enamide |
| SMILES | N#CCCN/C=C(/C#N)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H10ClF3N4O/c15-12-3-2-10(6-11(12)14(16,17)18)22-13(23)9(7-20)8-21-5-1-4-19/h2-3,6,8,21H,1,5H2,(H,22,23)/b9-8- |
| InChIKey | RKEMDQFTBVHXDO-HJWRWDBZSA-N |
| XLogP | 3.21 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.71 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|