C18H18BrN5O — CID 108828332
(Z)-3-[(5-bromopyrimidin-2-yl)amino]-N-(4-butylphenyl)-2-cyanoprop-2-enamide (PubChem CID 108828332) has the molecular formula C18H18BrN5O and a molecular weight of 400.28 g/mol. Its IUPAC name is (Z)-3-[(5-bromopyrimidin-2-yl)amino]-N-(4-butylphenyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[(5-bromopyrimidin-2-yl)amino]-N-(4-butylphenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108828332 |
| Molecular Formula | C18H18BrN5O |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | (Z)-3-[(5-bromopyrimidin-2-yl)amino]-N-(4-butylphenyl)-2-cyanoprop-2-enamide |
| SMILES | CCCCc1ccc(NC(=O)/C(C#N)=C\Nc2ncc(Br)cn2)cc1 |
| InChI | InChI=1S/C18H18BrN5O/c1-2-3-4-13-5-7-16(8-6-13)24-17(25)14(9-20)10-21-18-22-11-15(19)12-23-18/h5-8,10-12H,2-4H2,1H3,(H,24,25)(H,21,22,23)/b14-10- |
| InChIKey | JWYCFTKUPPTWPH-UVTDQMKNSA-N |
| XLogP | 4.04 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|