C22H25N3O — CID 108828093
(Z)-N-(4-butylphenyl)-2-cyano-3-(2,4-dimethylanilino)prop-2-enamide (PubChem CID 108828093) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is (Z)-N-(4-butylphenyl)-2-cyano-3-(2,4-dimethylanilino)prop-2-enamide.
| Compound Name | (Z)-N-(4-butylphenyl)-2-cyano-3-(2,4-dimethylanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108828093 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | (Z)-N-(4-butylphenyl)-2-cyano-3-(2,4-dimethylanilino)prop-2-enamide |
| SMILES | CCCCc1ccc(NC(=O)/C(C#N)=C\Nc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C22H25N3O/c1-4-5-6-18-8-10-20(11-9-18)25-22(26)19(14-23)15-24-21-12-7-16(2)13-17(21)3/h7-13,15,24H,4-6H2,1-3H3,(H,25,26)/b19-15- |
| InChIKey | JSUYLMULNRTVSU-CYVLTUHYSA-N |
| XLogP | 5.10 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|