C21H20N4OS — CID 108828193
[4-[[(Z)-3-(4-butylanilino)-2-cyano-3-oxoprop-1-enyl]amino]phenyl] thiocyanate (PubChem CID 108828193) has the molecular formula C21H20N4OS and a molecular weight of 376.49 g/mol. Its IUPAC name is [4-[[(Z)-3-(4-butylanilino)-2-cyano-3-oxoprop-1-enyl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[(Z)-3-(4-butylanilino)-2-cyano-3-oxoprop-1-enyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 108828193 |
| Molecular Formula | C21H20N4OS |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | [4-[[(Z)-3-(4-butylanilino)-2-cyano-3-oxoprop-1-enyl]amino]phenyl] thiocyanate |
| SMILES | CCCCc1ccc(NC(=O)/C(C#N)=C\Nc2ccc(SC#N)cc2)cc1 |
| InChI | InChI=1S/C21H20N4OS/c1-2-3-4-16-5-7-19(8-6-16)25-21(26)17(13-22)14-24-18-9-11-20(12-10-18)27-15-23/h5-12,14,24H,2-4H2,1H3,(H,25,26)/b17-14- |
| InChIKey | WZECQKOBANCDID-VKAVYKQESA-N |
| XLogP | 5.06 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|