C17H11BrN4OS — CID 108815890
[4-[[(Z)-3-(4-bromoanilino)-2-cyano-3-oxoprop-1-enyl]amino]phenyl] thiocyanate (PubChem CID 108815890) has the molecular formula C17H11BrN4OS and a molecular weight of 399.27 g/mol. Its IUPAC name is [4-[[(Z)-3-(4-bromoanilino)-2-cyano-3-oxoprop-1-enyl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[(Z)-3-(4-bromoanilino)-2-cyano-3-oxoprop-1-enyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 108815890 |
| Molecular Formula | C17H11BrN4OS |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 397.98 |
| IUPAC Name | [4-[[(Z)-3-(4-bromoanilino)-2-cyano-3-oxoprop-1-enyl]amino]phenyl] thiocyanate |
| SMILES | N#CSc1ccc(N/C=C(/C#N)C(=O)Nc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C17H11BrN4OS/c18-13-1-3-15(4-2-13)22-17(23)12(9-19)10-21-14-5-7-16(8-6-14)24-11-20/h1-8,10,21H,(H,22,23)/b12-10- |
| InChIKey | CFNSBANQBFWCKV-BENRWUELSA-N |
| XLogP | 4.48 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|