C19H14N4O2S — CID 108856432
[4-[[(Z)-3-(4-acetylanilino)-2-cyano-3-oxoprop-1-enyl]amino]phenyl] thiocyanate (PubChem CID 108856432) has the molecular formula C19H14N4O2S and a molecular weight of 362.41 g/mol. Its IUPAC name is [4-[[(Z)-3-(4-acetylanilino)-2-cyano-3-oxoprop-1-enyl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[(Z)-3-(4-acetylanilino)-2-cyano-3-oxoprop-1-enyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 108856432 |
| Molecular Formula | C19H14N4O2S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | [4-[[(Z)-3-(4-acetylanilino)-2-cyano-3-oxoprop-1-enyl]amino]phenyl] thiocyanate |
| SMILES | CC(=O)c1ccc(NC(=O)/C(C#N)=C\Nc2ccc(SC#N)cc2)cc1 |
| InChI | InChI=1S/C19H14N4O2S/c1-13(24)14-2-4-17(5-3-14)23-19(25)15(10-20)11-22-16-6-8-18(9-7-16)26-12-21/h2-9,11,22H,1H3,(H,23,25)/b15-11- |
| InChIKey | RMKDFYPCAUNQAW-PTNGSMBKSA-N |
| XLogP | 3.92 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|