C18H14N4OS — CID 108817380
[4-[[(Z)-2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]amino]phenyl] thiocyanate (PubChem CID 108817380) has the molecular formula C18H14N4OS and a molecular weight of 334.40 g/mol. Its IUPAC name is [4-[[(Z)-2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[(Z)-2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 108817380 |
| Molecular Formula | C18H14N4OS |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | [4-[[(Z)-2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]amino]phenyl] thiocyanate |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C\Nc2ccc(SC#N)cc2)cc1 |
| InChI | InChI=1S/C18H14N4OS/c1-13-2-4-16(5-3-13)22-18(23)14(10-19)11-21-15-6-8-17(9-7-15)24-12-20/h2-9,11,21H,1H3,(H,22,23)/b14-11- |
| InChIKey | DOLVZVUAHJPLHY-KAMYIIQDSA-N |
| XLogP | 4.03 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|