C18H15IN4O2 — CID 108818847
(Z)-N-(4-acetamidophenyl)-2-cyano-3-(4-iodoanilino)prop-2-enamide (PubChem CID 108818847) has the molecular formula C18H15IN4O2 and a molecular weight of 446.25 g/mol. Its IUPAC name is (Z)-N-(4-acetamidophenyl)-2-cyano-3-(4-iodoanilino)prop-2-enamide.
| Compound Name | (Z)-N-(4-acetamidophenyl)-2-cyano-3-(4-iodoanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108818847 |
| Molecular Formula | C18H15IN4O2 |
| Molecular Weight | 446.25 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | (Z)-N-(4-acetamidophenyl)-2-cyano-3-(4-iodoanilino)prop-2-enamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)/C(C#N)=C\Nc2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C18H15IN4O2/c1-12(24)22-16-6-8-17(9-7-16)23-18(25)13(10-20)11-21-15-4-2-14(19)3-5-15/h2-9,11,21H,1H3,(H,22,24)(H,23,25)/b13-11- |
| InChIKey | DSWRFGAKSXPFHD-QBFSEMIESA-N |
| XLogP | 3.71 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.25 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|