C24H18N4OS — CID 108840458
[4-[[(Z)-3-(benzhydrylamino)-2-cyano-3-oxoprop-1-enyl]amino]phenyl] thiocyanate (PubChem CID 108840458) has the molecular formula C24H18N4OS and a molecular weight of 410.50 g/mol. Its IUPAC name is [4-[[(Z)-3-(benzhydrylamino)-2-cyano-3-oxoprop-1-enyl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[(Z)-3-(benzhydrylamino)-2-cyano-3-oxoprop-1-enyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 108840458 |
| Molecular Formula | C24H18N4OS |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | [4-[[(Z)-3-(benzhydrylamino)-2-cyano-3-oxoprop-1-enyl]amino]phenyl] thiocyanate |
| SMILES | N#CSc1ccc(N/C=C(/C#N)C(=O)NC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H18N4OS/c25-15-20(16-27-21-11-13-22(14-12-21)30-17-26)24(29)28-23(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-14,16,23,27H,(H,28,29)/b20-16- |
| InChIKey | RUMXPKWGXLXQTC-SILNSSARSA-N |
| XLogP | 4.98 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|