C23H17F2N3O — CID 108840562
(Z)-N-benzhydryl-2-cyano-3-(2,5-difluoroanilino)prop-2-enamide (PubChem CID 108840562) has the molecular formula C23H17F2N3O and a molecular weight of 389.41 g/mol. Its IUPAC name is (Z)-N-benzhydryl-2-cyano-3-(2,5-difluoroanilino)prop-2-enamide.
| Compound Name | (Z)-N-benzhydryl-2-cyano-3-(2,5-difluoroanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108840562 |
| Molecular Formula | C23H17F2N3O |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (Z)-N-benzhydryl-2-cyano-3-(2,5-difluoroanilino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1cc(F)ccc1F)C(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H17F2N3O/c24-19-11-12-20(25)21(13-19)27-15-18(14-26)23(29)28-22(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-13,15,22,27H,(H,28,29)/b18-15- |
| InChIKey | PAPANLYWXBAUMZ-SDXDJHTJSA-N |
| XLogP | 4.69 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|