C16H10ClF2N3O — CID 108860591
(Z)-N-(3-chlorophenyl)-2-cyano-3-(2,5-difluoroanilino)prop-2-enamide (PubChem CID 108860591) has the molecular formula C16H10ClF2N3O and a molecular weight of 333.73 g/mol. Its IUPAC name is (Z)-N-(3-chlorophenyl)-2-cyano-3-(2,5-difluoroanilino)prop-2-enamide.
| Compound Name | (Z)-N-(3-chlorophenyl)-2-cyano-3-(2,5-difluoroanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108860591 |
| Molecular Formula | C16H10ClF2N3O |
| Molecular Weight | 333.73 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | (Z)-N-(3-chlorophenyl)-2-cyano-3-(2,5-difluoroanilino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1cc(F)ccc1F)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H10ClF2N3O/c17-11-2-1-3-13(6-11)22-16(23)10(8-20)9-21-15-7-12(18)4-5-14(15)19/h1-7,9,21H,(H,22,23)/b10-9- |
| InChIKey | SYYILWWJEHKKRN-KTKRTIGZSA-N |
| XLogP | 4.08 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.73 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|