C27H21N3O — CID 108840461
(Z)-N-benzhydryl-2-cyano-3-(naphthalen-1-ylamino)prop-2-enamide (PubChem CID 108840461) has the molecular formula C27H21N3O and a molecular weight of 403.49 g/mol. Its IUPAC name is (Z)-N-benzhydryl-2-cyano-3-(naphthalen-1-ylamino)prop-2-enamide.
| Compound Name | (Z)-N-benzhydryl-2-cyano-3-(naphthalen-1-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108840461 |
| Molecular Formula | C27H21N3O |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | (Z)-N-benzhydryl-2-cyano-3-(naphthalen-1-ylamino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1cccc2ccccc12)C(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H21N3O/c28-18-23(19-29-25-17-9-15-20-10-7-8-16-24(20)25)27(31)30-26(21-11-3-1-4-12-21)22-13-5-2-6-14-22/h1-17,19,26,29H,(H,30,31)/b23-19- |
| InChIKey | VBCRUKIXIIHSMJ-NMWGTECJSA-N |
| XLogP | 5.56 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|