C21H16ClN3O — CID 108839715
(Z)-N-[(4-chlorophenyl)methyl]-2-cyano-3-(naphthalen-1-ylamino)prop-2-enamide (PubChem CID 108839715) has the molecular formula C21H16ClN3O and a molecular weight of 361.83 g/mol. Its IUPAC name is (Z)-N-[(4-chlorophenyl)methyl]-2-cyano-3-(naphthalen-1-ylamino)prop-2-enamide.
| Compound Name | (Z)-N-[(4-chlorophenyl)methyl]-2-cyano-3-(naphthalen-1-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108839715 |
| Molecular Formula | C21H16ClN3O |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | (Z)-N-[(4-chlorophenyl)methyl]-2-cyano-3-(naphthalen-1-ylamino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1cccc2ccccc12)C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H16ClN3O/c22-18-10-8-15(9-11-18)13-25-21(26)17(12-23)14-24-20-7-3-5-16-4-1-2-6-19(16)20/h1-11,14,24H,13H2,(H,25,26)/b17-14- |
| InChIKey | MJTKTRVHOCLWLE-VKAVYKQESA-N |
| XLogP | 4.63 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|