C20H14ClN3O — CID 108824467
(Z)-N-(2-chlorophenyl)-2-cyano-3-(naphthalen-1-ylamino)prop-2-enamide (PubChem CID 108824467) has the molecular formula C20H14ClN3O and a molecular weight of 347.81 g/mol. Its IUPAC name is (Z)-N-(2-chlorophenyl)-2-cyano-3-(naphthalen-1-ylamino)prop-2-enamide.
| Compound Name | (Z)-N-(2-chlorophenyl)-2-cyano-3-(naphthalen-1-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108824467 |
| Molecular Formula | C20H14ClN3O |
| Molecular Weight | 347.81 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | (Z)-N-(2-chlorophenyl)-2-cyano-3-(naphthalen-1-ylamino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1cccc2ccccc12)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C20H14ClN3O/c21-17-9-3-4-10-19(17)24-20(25)15(12-22)13-23-18-11-5-7-14-6-1-2-8-16(14)18/h1-11,13,23H,(H,24,25)/b15-13- |
| InChIKey | SIYZCMVARGPEHR-SQFISAMPSA-N |
| XLogP | 4.95 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.81 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|