C16H9ClF3N3O — CID 108824561
(Z)-N-(2-chlorophenyl)-2-cyano-3-(2,3,4-trifluoroanilino)prop-2-enamide (PubChem CID 108824561) has the molecular formula C16H9ClF3N3O and a molecular weight of 351.72 g/mol. Its IUPAC name is (Z)-N-(2-chlorophenyl)-2-cyano-3-(2,3,4-trifluoroanilino)prop-2-enamide.
| Compound Name | (Z)-N-(2-chlorophenyl)-2-cyano-3-(2,3,4-trifluoroanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108824561 |
| Molecular Formula | C16H9ClF3N3O |
| Molecular Weight | 351.72 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | (Z)-N-(2-chlorophenyl)-2-cyano-3-(2,3,4-trifluoroanilino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc(F)c(F)c1F)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C16H9ClF3N3O/c17-10-3-1-2-4-12(10)23-16(24)9(7-21)8-22-13-6-5-11(18)14(19)15(13)20/h1-6,8,22H,(H,23,24)/b9-8- |
| InChIKey | YAKUZJMVJKFCIS-HJWRWDBZSA-N |
| XLogP | 4.22 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.72 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|