C21H17N3O — CID 108858673
(Z)-2-cyano-N-(3-methylphenyl)-3-(naphthalen-1-ylamino)prop-2-enamide (PubChem CID 108858673) has the molecular formula C21H17N3O and a molecular weight of 327.39 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3-methylphenyl)-3-(naphthalen-1-ylamino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3-methylphenyl)-3-(naphthalen-1-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108858673 |
| Molecular Formula | C21H17N3O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (Z)-2-cyano-N-(3-methylphenyl)-3-(naphthalen-1-ylamino)prop-2-enamide |
| SMILES | Cc1cccc(NC(=O)/C(C#N)=C\Nc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C21H17N3O/c1-15-6-4-9-18(12-15)24-21(25)17(13-22)14-23-20-11-5-8-16-7-2-3-10-19(16)20/h2-12,14,23H,1H3,(H,24,25)/b17-14- |
| InChIKey | JRQUGPZFKMDPIK-VKAVYKQESA-N |
| XLogP | 4.61 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|