C18H17N3O2 — CID 108817050
(Z)-2-cyano-3-(2,5-dimethylanilino)-N-(3-hydroxyphenyl)prop-2-enamide (PubChem CID 108817050) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,5-dimethylanilino)-N-(3-hydroxyphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,5-dimethylanilino)-N-(3-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108817050 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | (Z)-2-cyano-3-(2,5-dimethylanilino)-N-(3-hydroxyphenyl)prop-2-enamide |
| SMILES | Cc1ccc(C)c(N/C=C(/C#N)C(=O)Nc2cccc(O)c2)c1 |
| InChI | InChI=1S/C18H17N3O2/c1-12-6-7-13(2)17(8-12)20-11-14(10-19)18(23)21-15-4-3-5-16(22)9-15/h3-9,11,20,22H,1-2H3,(H,21,23)/b14-11- |
| InChIKey | PNNWHVAFQDOODM-KAMYIIQDSA-N |
| XLogP | 3.47 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|