C16H13N3O2 — CID 108816953
(Z)-3-anilino-2-cyano-N-(3-hydroxyphenyl)prop-2-enamide (PubChem CID 108816953) has the molecular formula C16H13N3O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is (Z)-3-anilino-2-cyano-N-(3-hydroxyphenyl)prop-2-enamide.
| Compound Name | (Z)-3-anilino-2-cyano-N-(3-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108816953 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | (Z)-3-anilino-2-cyano-N-(3-hydroxyphenyl)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccccc1)C(=O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C16H13N3O2/c17-10-12(11-18-13-5-2-1-3-6-13)16(21)19-14-7-4-8-15(20)9-14/h1-9,11,18,20H,(H,19,21)/b12-11- |
| InChIKey | ITKUOIYCPKYLGX-QXMHVHEDSA-N |
| XLogP | 2.85 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|