C19H17N3O3 — CID 108816304
3-[[(Z)-2-cyano-3-(2,5-dimethylanilino)prop-2-enoyl]amino]benzoic acid (PubChem CID 108816304) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is 3-[[(Z)-2-cyano-3-(2,5-dimethylanilino)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 3-[[(Z)-2-cyano-3-(2,5-dimethylanilino)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108816304 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 3-[[(Z)-2-cyano-3-(2,5-dimethylanilino)prop-2-enoyl]amino]benzoic acid |
| SMILES | Cc1ccc(C)c(N/C=C(/C#N)C(=O)Nc2cccc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C19H17N3O3/c1-12-6-7-13(2)17(8-12)21-11-15(10-20)18(23)22-16-5-3-4-14(9-16)19(24)25/h3-9,11,21H,1-2H3,(H,22,23)(H,24,25)/b15-11- |
| InChIKey | JJLRXBXJPIGQAO-PTNGSMBKSA-N |
| XLogP | 3.46 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|