C15H16N4O4 — CID 108816310
3-[[(Z)-3-(2-acetamidoethylamino)-2-cyanoprop-2-enoyl]amino]benzoic acid (PubChem CID 108816310) has the molecular formula C15H16N4O4 and a molecular weight of 316.32 g/mol. Its IUPAC name is 3-[[(Z)-3-(2-acetamidoethylamino)-2-cyanoprop-2-enoyl]amino]benzoic acid.
| Compound Name | 3-[[(Z)-3-(2-acetamidoethylamino)-2-cyanoprop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108816310 |
| Molecular Formula | C15H16N4O4 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 3-[[(Z)-3-(2-acetamidoethylamino)-2-cyanoprop-2-enoyl]amino]benzoic acid |
| SMILES | CC(=O)NCCN/C=C(/C#N)C(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C15H16N4O4/c1-10(20)18-6-5-17-9-12(8-16)14(21)19-13-4-2-3-11(7-13)15(22)23/h2-4,7,9,17H,5-6H2,1H3,(H,18,20)(H,19,21)(H,22,23)/b12-9- |
| InChIKey | AUWMLJCQVUOLOH-XFXZXTDPSA-N |
| XLogP | 0.46 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|