C16H19N3O4 — CID 108816242
3-[[(Z)-2-cyano-3-(5-hydroxypentylamino)prop-2-enoyl]amino]benzoic acid (PubChem CID 108816242) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is 3-[[(Z)-2-cyano-3-(5-hydroxypentylamino)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 3-[[(Z)-2-cyano-3-(5-hydroxypentylamino)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108816242 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 3-[[(Z)-2-cyano-3-(5-hydroxypentylamino)prop-2-enoyl]amino]benzoic acid |
| SMILES | N#C/C(=C/NCCCCCO)C(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C16H19N3O4/c17-10-13(11-18-7-2-1-3-8-20)15(21)19-14-6-4-5-12(9-14)16(22)23/h4-6,9,11,18,20H,1-3,7-8H2,(H,19,21)(H,22,23)/b13-11- |
| InChIKey | FWTWZXGIUZJTSU-QBFSEMIESA-N |
| XLogP | 1.48 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|