C15H17N3O5 — CID 108816126
3-[[(Z)-3-[bis(2-hydroxyethyl)amino]-2-cyanoprop-2-enoyl]amino]benzoic acid (PubChem CID 108816126) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is 3-[[(Z)-3-[bis(2-hydroxyethyl)amino]-2-cyanoprop-2-enoyl]amino]benzoic acid.
| Compound Name | 3-[[(Z)-3-[bis(2-hydroxyethyl)amino]-2-cyanoprop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108816126 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 3-[[(Z)-3-[bis(2-hydroxyethyl)amino]-2-cyanoprop-2-enoyl]amino]benzoic acid |
| SMILES | N#C/C(=C/N(CCO)CCO)C(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C15H17N3O5/c16-9-12(10-18(4-6-19)5-7-20)14(21)17-13-3-1-2-11(8-13)15(22)23/h1-3,8,10,19-20H,4-7H2,(H,17,21)(H,22,23)/b12-10- |
| InChIKey | DKFPQWWBAIADTO-BENRWUELSA-N |
| XLogP | 0.02 |
| TPSA | 133.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|