C17H20N4O4 — CID 108816217
3-[[(Z)-2-cyano-3-[4-(2-hydroxyethyl)piperazin-1-yl]prop-2-enoyl]amino]benzoic acid (PubChem CID 108816217) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is 3-[[(Z)-2-cyano-3-[4-(2-hydroxyethyl)piperazin-1-yl]prop-2-enoyl]amino]benzoic acid.
| Compound Name | 3-[[(Z)-2-cyano-3-[4-(2-hydroxyethyl)piperazin-1-yl]prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108816217 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 3-[[(Z)-2-cyano-3-[4-(2-hydroxyethyl)piperazin-1-yl]prop-2-enoyl]amino]benzoic acid |
| SMILES | N#C/C(=C/N1CCN(CCO)CC1)C(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C17H20N4O4/c18-11-14(12-21-6-4-20(5-7-21)8-9-22)16(23)19-15-3-1-2-13(10-15)17(24)25/h1-3,10,12,22H,4-9H2,(H,19,23)(H,24,25)/b14-12- |
| InChIKey | YUOPSBRBQGTULQ-OWBHPGMISA-N |
| XLogP | 0.34 |
| TPSA | 116.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|