C18H19N3O4 — CID 108856636
1-[(Z)-3-(3-acetylanilino)-2-cyano-3-oxoprop-1-enyl]piperidine-4-carboxylic acid (PubChem CID 108856636) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 1-[(Z)-3-(3-acetylanilino)-2-cyano-3-oxoprop-1-enyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(Z)-3-(3-acetylanilino)-2-cyano-3-oxoprop-1-enyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 108856636 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-[(Z)-3-(3-acetylanilino)-2-cyano-3-oxoprop-1-enyl]piperidine-4-carboxylic acid |
| SMILES | CC(=O)c1cccc(NC(=O)/C(C#N)=C\N2CCC(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C18H19N3O4/c1-12(22)14-3-2-4-16(9-14)20-17(23)15(10-19)11-21-7-5-13(6-8-21)18(24)25/h2-4,9,11,13H,5-8H2,1H3,(H,20,23)(H,24,25)/b15-11- |
| InChIKey | HNZQLQQLMJEMDG-PTNGSMBKSA-N |
| XLogP | 2.03 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|