C21H19N3O2 — CID 108856783
(Z)-N-(3-acetylphenyl)-2-cyano-3-(3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enamide (PubChem CID 108856783) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is (Z)-N-(3-acetylphenyl)-2-cyano-3-(3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enamide.
| Compound Name | (Z)-N-(3-acetylphenyl)-2-cyano-3-(3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108856783 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | (Z)-N-(3-acetylphenyl)-2-cyano-3-(3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enamide |
| SMILES | CC(=O)c1cccc(NC(=O)/C(C#N)=C\N2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C21H19N3O2/c1-15(25)17-7-4-8-20(11-17)23-21(26)19(12-22)14-24-10-9-16-5-2-3-6-18(16)13-24/h2-8,11,14H,9-10,13H2,1H3,(H,23,26)/b19-14- |
| InChIKey | JTMGHCIWGFKICS-RGEXLXHISA-N |
| XLogP | 3.29 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|