C24H26N4O2 — CID 108856881
(Z)-N-(3-acetylphenyl)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enamide (PubChem CID 108856881) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is (Z)-N-(3-acetylphenyl)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enamide.
| Compound Name | (Z)-N-(3-acetylphenyl)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 108856881 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (Z)-N-(3-acetylphenyl)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enamide |
| SMILES | CC(=O)c1cccc(NC(=O)/C(C#N)=C\N2CCN(c3cccc(C)c3C)CC2)c1 |
| InChI | InChI=1S/C24H26N4O2/c1-17-6-4-9-23(18(17)2)28-12-10-27(11-13-28)16-21(15-25)24(30)26-22-8-5-7-20(14-22)19(3)29/h4-9,14,16H,10-13H2,1-3H3,(H,26,30)/b21-16- |
| InChIKey | VFIWSZUQHBILCM-PGMHBOJBSA-N |
| XLogP | 3.67 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|