C22H24ClN5O3 — CID 108853523
(Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(3-nitrophenyl)prop-2-enamide;hydrochloride (PubChem CID 108853523) has the molecular formula C22H24ClN5O3 and a molecular weight of 441.92 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(3-nitrophenyl)prop-2-enamide;hydrochloride.
| Compound Name | (Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(3-nitrophenyl)prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 108853523 |
| Molecular Formula | C22H24ClN5O3 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | (Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(3-nitrophenyl)prop-2-enamide;hydrochloride |
| SMILES | Cc1cccc(N2CCN(/C=C(/C#N)C(=O)Nc3cccc([N+](=O)[O-])c3)CC2)c1C.Cl |
| InChI | InChI=1S/C22H23N5O3.ClH/c1-16-5-3-8-21(17(16)2)26-11-9-25(10-12-26)15-18(14-23)22(28)24-19-6-4-7-20(13-19)27(29)30;/h3-8,13,15H,9-12H2,1-2H3,(H,24,28);1H/b18-15-; |
| InChIKey | HGBAHRGTBGWSFV-MWIGPOFTSA-N |
| XLogP | 3.80 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|