C21H21N5O4 — CID 108853485
(Z)-2-cyano-3-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 108853485) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108853485 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | (Z)-2-cyano-3-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | COc1ccccc1N1CCN(/C=C(/C#N)C(=O)Nc2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C21H21N5O4/c1-30-20-8-3-2-7-19(20)25-11-9-24(10-12-25)15-16(14-22)21(27)23-17-5-4-6-18(13-17)26(28)29/h2-8,13,15H,9-12H2,1H3,(H,23,27)/b16-15- |
| InChIKey | RYECJFNKCRJGMP-NXVVXOECSA-N |
| XLogP | 2.77 |
| TPSA | 111.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|