C21H28N4O2 — CID 108831570
(Z)-2-cyano-N-cyclohexyl-3-[4-(2-methoxyphenyl)piperazin-1-yl]prop-2-enamide (PubChem CID 108831570) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is (Z)-2-cyano-N-cyclohexyl-3-[4-(2-methoxyphenyl)piperazin-1-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-cyclohexyl-3-[4-(2-methoxyphenyl)piperazin-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 108831570 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | (Z)-2-cyano-N-cyclohexyl-3-[4-(2-methoxyphenyl)piperazin-1-yl]prop-2-enamide |
| SMILES | COc1ccccc1N1CCN(/C=C(/C#N)C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C21H28N4O2/c1-27-20-10-6-5-9-19(20)25-13-11-24(12-14-25)16-17(15-22)21(26)23-18-7-3-2-4-8-18/h5-6,9-10,16,18H,2-4,7-8,11-14H2,1H3,(H,23,26)/b17-16- |
| InChIKey | HPHXDLJJPHRZCZ-MSUUIHNZSA-N |
| XLogP | 2.67 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|