C18H22N4O4 — CID 108817790
3-[[(Z)-2-cyano-3-[4-(2-methoxyphenyl)piperazin-1-yl]prop-2-enoyl]amino]propanoic acid (PubChem CID 108817790) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is 3-[[(Z)-2-cyano-3-[4-(2-methoxyphenyl)piperazin-1-yl]prop-2-enoyl]amino]propanoic acid.
| Compound Name | 3-[[(Z)-2-cyano-3-[4-(2-methoxyphenyl)piperazin-1-yl]prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 108817790 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 3-[[(Z)-2-cyano-3-[4-(2-methoxyphenyl)piperazin-1-yl]prop-2-enoyl]amino]propanoic acid |
| SMILES | COc1ccccc1N1CCN(/C=C(/C#N)C(=O)NCCC(=O)O)CC1 |
| InChI | InChI=1S/C18H22N4O4/c1-26-16-5-3-2-4-15(16)22-10-8-21(9-11-22)13-14(12-19)18(25)20-7-6-17(23)24/h2-5,13H,6-11H2,1H3,(H,20,25)(H,23,24)/b14-13- |
| InChIKey | XLFHLYSZFVPMSL-YPKPFQOOSA-N |
| XLogP | 0.82 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|