C22H34N4O3 — CID 42389613
N'-cyclohexyl-N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]oxamide (PubChem CID 42389613) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is N'-cyclohexyl-N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]oxamide.
| Compound Name | N'-cyclohexyl-N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]oxamide |
|---|---|
| PubChem CID | 42389613 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | N'-cyclohexyl-N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]oxamide |
| SMILES | COc1ccccc1N1CCN(CCCNC(=O)C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C22H34N4O3/c1-29-20-11-6-5-10-19(20)26-16-14-25(15-17-26)13-7-12-23-21(27)22(28)24-18-8-3-2-4-9-18/h5-6,10-11,18H,2-4,7-9,12-17H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | QMAUUAMHGQFFLX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|