C27H39ClN4O3 — CID 70516087
[5-(cyclohexylmethyl)-2-pyridinyl] N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]carbamate;hydrochloride (PubChem CID 70516087) has the molecular formula C27H39ClN4O3 and a molecular weight of 503.09 g/mol. Its IUPAC name is [5-(cyclohexylmethyl)-2-pyridinyl] N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]carbamate;hydrochloride.
| Compound Name | [5-(cyclohexylmethyl)-2-pyridinyl] N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 70516087 |
| Molecular Formula | C27H39ClN4O3 |
| Molecular Weight | 503.09 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | [5-(cyclohexylmethyl)-2-pyridinyl] N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]carbamate;hydrochloride |
| SMILES | COc1ccccc1N1CCN(CCCNC(=O)Oc2ccc(CC3CCCCC3)cn2)CC1.Cl |
| InChI | InChI=1S/C27H38N4O3.ClH/c1-33-25-11-6-5-10-24(25)31-18-16-30(17-19-31)15-7-14-28-27(32)34-26-13-12-23(21-29-26)20-22-8-3-2-4-9-22;/h5-6,10-13,21-22H,2-4,7-9,14-20H2,1H3,(H,28,32);1H |
| InChIKey | BTOHFHANWWLFDF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.09 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|