C21H27BrN4O2 — CID 23609325
1-(2-bromophenyl)-3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]urea (PubChem CID 23609325) has the molecular formula C21H27BrN4O2 and a molecular weight of 447.38 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]urea.
| Compound Name | 1-(2-bromophenyl)-3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]urea |
|---|---|
| PubChem CID | 23609325 |
| Molecular Formula | C21H27BrN4O2 |
| Molecular Weight | 447.38 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 1-(2-bromophenyl)-3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]urea |
| SMILES | COc1ccccc1N1CCN(CCCNC(=O)Nc2ccccc2Br)CC1 |
| InChI | InChI=1S/C21H27BrN4O2/c1-28-20-10-5-4-9-19(20)26-15-13-25(14-16-26)12-6-11-23-21(27)24-18-8-3-2-7-17(18)22/h2-5,7-10H,6,11-16H2,1H3,(H2,23,24,27) |
| InChIKey | BQCYCTQFRNHHRU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|