C28H37N5O3 — CID 20924541
1-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-[2-(2-methylpropyl)-1-oxoisoquinolin-4-yl]urea (PubChem CID 20924541) has the molecular formula C28H37N5O3 and a molecular weight of 491.64 g/mol. Its IUPAC name is 1-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-[2-(2-methylpropyl)-1-oxoisoquinolin-4-yl]urea.
| Compound Name | 1-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-[2-(2-methylpropyl)-1-oxoisoquinolin-4-yl]urea |
|---|---|
| PubChem CID | 20924541 |
| Molecular Formula | C28H37N5O3 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | 1-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-[2-(2-methylpropyl)-1-oxoisoquinolin-4-yl]urea |
| SMILES | COc1ccccc1N1CCN(CCCNC(=O)Nc2cn(CC(C)C)c(=O)c3ccccc23)CC1 |
| InChI | InChI=1S/C28H37N5O3/c1-21(2)19-33-20-24(22-9-4-5-10-23(22)27(33)34)30-28(35)29-13-8-14-31-15-17-32(18-16-31)25-11-6-7-12-26(25)36-3/h4-7,9-12,20-21H,8,13-19H2,1-3H3,(H2,29,30,35) |
| InChIKey | HTZXEJUXEXMDNE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|