C27H41N5O2 — CID 22334842
1-[3-(4-cyclohexylpiperazin-1-yl)propyl]-3-[2-(2-methylpropyl)-1-oxoisoquinolin-4-yl]urea (PubChem CID 22334842) has the molecular formula C27H41N5O2 and a molecular weight of 467.66 g/mol. Its IUPAC name is 1-[3-(4-cyclohexylpiperazin-1-yl)propyl]-3-[2-(2-methylpropyl)-1-oxoisoquinolin-4-yl]urea.
| Compound Name | 1-[3-(4-cyclohexylpiperazin-1-yl)propyl]-3-[2-(2-methylpropyl)-1-oxoisoquinolin-4-yl]urea |
|---|---|
| PubChem CID | 22334842 |
| Molecular Formula | C27H41N5O2 |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.33 |
| IUPAC Name | 1-[3-(4-cyclohexylpiperazin-1-yl)propyl]-3-[2-(2-methylpropyl)-1-oxoisoquinolin-4-yl]urea |
| SMILES | CC(C)Cn1cc(NC(=O)NCCCN2CCN(C3CCCCC3)CC2)c2ccccc2c1=O |
| InChI | InChI=1S/C27H41N5O2/c1-21(2)19-32-20-25(23-11-6-7-12-24(23)26(32)33)29-27(34)28-13-8-14-30-15-17-31(18-16-30)22-9-4-3-5-10-22/h6-7,11-12,20-22H,3-5,8-10,13-19H2,1-2H3,(H2,28,29,34) |
| InChIKey | DLTTYBHRFRZYIP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 69.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|