C23H27N3O5 — CID 20924390
1-[2-(2-methylpropyl)-1-oxoisoquinolin-4-yl]-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 20924390) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is 1-[2-(2-methylpropyl)-1-oxoisoquinolin-4-yl]-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[2-(2-methylpropyl)-1-oxoisoquinolin-4-yl]-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 20924390 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 1-[2-(2-methylpropyl)-1-oxoisoquinolin-4-yl]-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)Nc2cn(CC(C)C)c(=O)c3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C23H27N3O5/c1-14(2)12-26-13-18(16-8-6-7-9-17(16)22(26)27)25-23(28)24-15-10-19(29-3)21(31-5)20(11-15)30-4/h6-11,13-14H,12H2,1-5H3,(H2,24,25,28) |
| InChIKey | XQPVDYJZGYRAOC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |