C18H20N2O6 — CID 17374900
methyl 2-[(3,4,5-trimethoxyphenyl)carbamoylamino]benzoate (PubChem CID 17374900) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is methyl 2-[(3,4,5-trimethoxyphenyl)carbamoylamino]benzoate.
| Compound Name | methyl 2-[(3,4,5-trimethoxyphenyl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 17374900 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | methyl 2-[(3,4,5-trimethoxyphenyl)carbamoylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)Nc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C18H20N2O6/c1-23-14-9-11(10-15(24-2)16(14)25-3)19-18(22)20-13-8-6-5-7-12(13)17(21)26-4/h5-10H,1-4H3,(H2,19,20,22) |
| InChIKey | DMZODEAJXDOCLG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |