methyl 2-[(3,4,5-trimethoxyphenyl)carbamoylamino]benzoate

C18H20N2O6 — CID 17374900

IUPACmethyl 2-[(3,4,5-trimethoxyphenyl)carbamoylamino]benzoate
SMILESCOC(=O)c1ccccc1NC(=O)Nc1cc(OC)c(OC)c(OC)c1
InChIInChI=1S/C18H20N2O6/c1-23-14-9-11(10-15(24-2)16(14)25-3)19-18(22)20-13-8-6-5-7-12(13)17(21)26-4/h5-10H,1-4H3,(H2,19,20,22)
InChIKeyDMZODEAJXDOCLG-UHFFFAOYSA-N
MW360.37 g/mol
LogP3.14
Rot. Bonds6

About methyl 2-[(3,4,5-trimethoxyphenyl)carbamoylamino]benzoate

methyl 2-[(3,4,5-trimethoxyphenyl)carbamoylamino]benzoate (PubChem CID 17374900) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is methyl 2-[(3,4,5-trimethoxyphenyl)carbamoylamino]benzoate.

Molecular Properties

Compound Namemethyl 2-[(3,4,5-trimethoxyphenyl)carbamoylamino]benzoate
PubChem CID17374900
Molecular FormulaC18H20N2O6
Molecular Weight360.37 g/mol
Exact Mass360.13
IUPAC Namemethyl 2-[(3,4,5-trimethoxyphenyl)carbamoylamino]benzoate
SMILESCOC(=O)c1ccccc1NC(=O)Nc1cc(OC)c(OC)c(OC)c1
InChIInChI=1S/C18H20N2O6/c1-23-14-9-11(10-15(24-2)16(14)25-3)19-18(22)20-13-8-6-5-7-12(13)17(21)26-4/h5-10H,1-4H3,(H2,19,20,22)
InChIKeyDMZODEAJXDOCLG-UHFFFAOYSA-N
XLogP3.14
TPSA95.12 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500360.37
LogP ≤ 53.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze methyl 2-[(3,4,5-trimethoxyphenyl)carbamoylamino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(3,4,5-trimethoxyphenyl)carbamoylamino]benzoate?
The IUPAC name of methyl 2-[(3,4,5-trimethoxyphenyl)carbamoylamino]benzoate (CID 17374900) is methyl 2-[(3,4,5-trimethoxyphenyl)carbamoylamino]benzoate.
What is the SMILES notation for methyl 2-[(3,4,5-trimethoxyphenyl)carbamoylamino]benzoate?
The canonical SMILES for methyl 2-[(3,4,5-trimethoxyphenyl)carbamoylamino]benzoate is COC(=O)c1ccccc1NC(=O)Nc1cc(OC)c(OC)c(OC)c1.
What is the InChIKey of methyl 2-[(3,4,5-trimethoxyphenyl)carbamoylamino]benzoate?
The InChIKey is DMZODEAJXDOCLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O6/c1-23-14-9-11(10-15(24-2)16(14)25-3)19-18(22)20-13-8-6-5-7-12(13)17(21)26-4/h5-10H,1-4H3,(H2,19,20,22).
What are the key properties of methyl 2-[(3,4,5-trimethoxyphenyl)carbamoylamino]benzoate?
methyl 2-[(3,4,5-trimethoxyphenyl)carbamoylamino]benzoate has a molecular weight of 360.37 g/mol, XLogP of 3.14, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3,4,5-trimethoxyphenyl)carbamoylamino]benzoate is sourced from PubChem (CID 17374900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).