C11H16N2O4 — CID 17171369
1-methyl-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 17171369) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 1-methyl-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-methyl-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 17171369 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 1-methyl-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | CNC(=O)Nc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C11H16N2O4/c1-12-11(14)13-7-5-8(15-2)10(17-4)9(6-7)16-3/h5-6H,1-4H3,(H2,12,13,14) |
| InChIKey | RKYCCIPQQIUCBK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |